C11H25NO4S — CID 114228834
3-methoxy-1-(3-methoxypropylsulfonyl)-N,3-dimethylbutan-2-amine (PubChem CID 114228834) has the molecular formula C11H25NO4S and a molecular weight of 267.39 g/mol. Its IUPAC name is 3-methoxy-1-(3-methoxypropylsulfonyl)-N,3-dimethylbutan-2-amine.
| Compound Name | 3-methoxy-1-(3-methoxypropylsulfonyl)-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 114228834 |
| Molecular Formula | C11H25NO4S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 3-methoxy-1-(3-methoxypropylsulfonyl)-N,3-dimethylbutan-2-amine |
| SMILES | CNC(CS(=O)(=O)CCCOC)C(C)(C)OC |
| InChI | InChI=1S/C11H25NO4S/c1-11(2,16-5)10(12-3)9-17(13,14)8-6-7-15-4/h10,12H,6-9H2,1-5H3 |
| InChIKey | MORWWINEIXDGMQ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|