C13H21NO3S — CID 114228820
1-(benzenesulfonyl)-3-methoxy-N,3-dimethylbutan-2-amine (PubChem CID 114228820) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-methoxy-N,3-dimethylbutan-2-amine.
| Compound Name | 1-(benzenesulfonyl)-3-methoxy-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 114228820 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(benzenesulfonyl)-3-methoxy-N,3-dimethylbutan-2-amine |
| SMILES | CNC(CS(=O)(=O)c1ccccc1)C(C)(C)OC |
| InChI | InChI=1S/C13H21NO3S/c1-13(2,17-4)12(14-3)10-18(15,16)11-8-6-5-7-9-11/h5-9,12,14H,10H2,1-4H3 |
| InChIKey | CFVCHOXKHHBPQL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |