C12H17FO4S — CID 114228870
1-(4-fluorophenyl)sulfonyl-3-methoxy-3-methylbutan-2-ol (PubChem CID 114228870) has the molecular formula C12H17FO4S and a molecular weight of 276.33 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-methoxy-3-methylbutan-2-ol.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-methoxy-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 114228870 |
| Molecular Formula | C12H17FO4S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-methoxy-3-methylbutan-2-ol |
| SMILES | COC(C)(C)C(O)CS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H17FO4S/c1-12(2,17-3)11(14)8-18(15,16)10-6-4-9(13)5-7-10/h4-7,11,14H,8H2,1-3H3 |
| InChIKey | ZJHRPYYPHGHAKE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |