C13H19FO5S — CID 106993090
1-(4-fluorophenyl)sulfonyl-3-(1-methoxypropan-2-yloxy)propan-2-ol (PubChem CID 106993090) has the molecular formula C13H19FO5S and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-(1-methoxypropan-2-yloxy)propan-2-ol.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
|---|---|
| PubChem CID | 106993090 |
| Molecular Formula | C13H19FO5S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-(1-methoxypropan-2-yloxy)propan-2-ol |
| SMILES | COCC(C)OCC(O)CS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H19FO5S/c1-10(7-18-2)19-8-12(15)9-20(16,17)13-5-3-11(14)4-6-13/h3-6,10,12,15H,7-9H2,1-2H3 |
| InChIKey | ZNYMWOONFDYZHF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |