C12H26N2 — CID 105299129
(1-cyclopentyl-3,4-dimethylpentan-2-yl)hydrazine (PubChem CID 105299129) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (1-cyclopentyl-3,4-dimethylpentan-2-yl)hydrazine.
| Compound Name | (1-cyclopentyl-3,4-dimethylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105299129 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (1-cyclopentyl-3,4-dimethylpentan-2-yl)hydrazine |
| SMILES | CC(C)C(C)C(CC1CCCC1)NN |
| InChI | InChI=1S/C12H26N2/c1-9(2)10(3)12(14-13)8-11-6-4-5-7-11/h9-12,14H,4-8,13H2,1-3H3 |
| InChIKey | WHNQPEAYXDEDCM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|