C12H25N — CID 167019095
(2S)-1-cyclohexyl-N,3-dimethylbutan-2-amine (PubChem CID 167019095) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (2S)-1-cyclohexyl-N,3-dimethylbutan-2-amine.
| Compound Name | (2S)-1-cyclohexyl-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 167019095 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (2S)-1-cyclohexyl-N,3-dimethylbutan-2-amine |
| SMILES | CN[C@@H](CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C12H25N/c1-10(2)12(13-3)9-11-7-5-4-6-8-11/h10-13H,4-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | ULHXIKBCVSFZNS-LBPRGKRZSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |