C10H19F2N — CID 80604795
3-cyclohexyl-1,1-difluoro-N-methylpropan-2-amine (PubChem CID 80604795) has the molecular formula C10H19F2N and a molecular weight of 191.26 g/mol. Its IUPAC name is 3-cyclohexyl-1,1-difluoro-N-methylpropan-2-amine.
| Compound Name | 3-cyclohexyl-1,1-difluoro-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 80604795 |
| Molecular Formula | C10H19F2N |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 3-cyclohexyl-1,1-difluoro-N-methylpropan-2-amine |
| SMILES | CNC(CC1CCCCC1)C(F)F |
| InChI | InChI=1S/C10H19F2N/c1-13-9(10(11)12)7-8-5-3-2-4-6-8/h8-10,13H,2-7H2,1H3 |
| InChIKey | ZMGINUCUVCCOQI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |