C13H25N — CID 62601762
1,2-dicyclopentyl-N-methylethanamine (PubChem CID 62601762) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1,2-dicyclopentyl-N-methylethanamine.
| Compound Name | 1,2-dicyclopentyl-N-methylethanamine |
|---|---|
| PubChem CID | 62601762 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1,2-dicyclopentyl-N-methylethanamine |
| SMILES | CNC(CC1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C13H25N/c1-14-13(12-8-4-5-9-12)10-11-6-2-3-7-11/h11-14H,2-10H2,1H3 |
| InChIKey | VTPYVIRTHIZMQM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |