C12H23N — CID 65456991
1,2-di(cyclobutyl)-N-ethylethanamine (PubChem CID 65456991) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1,2-di(cyclobutyl)-N-ethylethanamine.
| Compound Name | 1,2-di(cyclobutyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 65456991 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1,2-di(cyclobutyl)-N-ethylethanamine |
| SMILES | CCNC(CC1CCC1)C1CCC1 |
| InChI | InChI=1S/C12H23N/c1-2-13-12(11-7-4-8-11)9-10-5-3-6-10/h10-13H,2-9H2,1H3 |
| InChIKey | OOIYGXFGCRDNNU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |