C8H14F2O — CID 112575466
3-cyclopentyl-1,1-difluoropropan-2-ol (PubChem CID 112575466) has the molecular formula C8H14F2O and a molecular weight of 164.20 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-difluoropropan-2-ol.
| Compound Name | 3-cyclopentyl-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 112575466 |
| Molecular Formula | C8H14F2O |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | 3-cyclopentyl-1,1-difluoropropan-2-ol |
| SMILES | OC(CC1CCCC1)C(F)F |
| InChI | InChI=1S/C8H14F2O/c9-8(10)7(11)5-6-3-1-2-4-6/h6-8,11H,1-5H2 |
| InChIKey | ZICREABVDJBIDK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |