About 1-cyclopropyl-N,3-dimethylbutan-2-amine
1-cyclopropyl-N,3-dimethylbutan-2-amine (PubChem CID 64903822) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 1-cyclopropyl-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 1-cyclopropyl-N,3-dimethylbutan-2-amine |
| PubChem CID | 64903822 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1-cyclopropyl-N,3-dimethylbutan-2-amine |
| SMILES | CNC(CC1CC1)C(C)C |
| InChI | InChI=1S/C9H19N/c1-7(2)9(10-3)6-8-4-5-8/h7-10H,4-6H2,1-3H3 |
| InChIKey | OBWUKAOAMULMNX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopropyl-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N,3-dimethylbutan-2-amine?
The IUPAC name of 1-cyclopropyl-N,3-dimethylbutan-2-amine (CID 64903822) is 1-cyclopropyl-N,3-dimethylbutan-2-amine.
What is the SMILES notation for 1-cyclopropyl-N,3-dimethylbutan-2-amine?
The canonical SMILES for 1-cyclopropyl-N,3-dimethylbutan-2-amine is CNC(CC1CC1)C(C)C.
What is the InChIKey of 1-cyclopropyl-N,3-dimethylbutan-2-amine?
The InChIKey is OBWUKAOAMULMNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N/c1-7(2)9(10-3)6-8-4-5-8/h7-10H,4-6H2,1-3H3.
What are the key properties of 1-cyclopropyl-N,3-dimethylbutan-2-amine?
1-cyclopropyl-N,3-dimethylbutan-2-amine has a molecular weight of 141.26 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 64903822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).