C9H19N — CID 64903822
1-cyclopropyl-N,3-dimethylbutan-2-amine (PubChem CID 64903822) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is 1-cyclopropyl-N,3-dimethylbutan-2-amine.
| Compound Name | 1-cyclopropyl-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 64903822 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 1-cyclopropyl-N,3-dimethylbutan-2-amine |
| SMILES | CNC(CC1CC1)C(C)C |
| InChI | InChI=1S/C9H19N/c1-7(2)9(10-3)6-8-4-5-8/h7-10H,4-6H2,1-3H3 |
| InChIKey | OBWUKAOAMULMNX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |