C13H27NO — CID 116724473
1-cyclobutyl-3-methoxy-N,4,4-trimethylpentan-2-amine (PubChem CID 116724473) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-cyclobutyl-3-methoxy-N,4,4-trimethylpentan-2-amine.
| Compound Name | 1-cyclobutyl-3-methoxy-N,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 116724473 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-cyclobutyl-3-methoxy-N,4,4-trimethylpentan-2-amine |
| SMILES | CNC(CC1CCC1)C(OC)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-13(2,3)12(15-5)11(14-4)9-10-7-6-8-10/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | INEJYKYMUIWSIC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |