C14H31NO — CID 116724435
3-methoxy-N,2,2,7,7-pentamethyloctan-4-amine (PubChem CID 116724435) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is 3-methoxy-N,2,2,7,7-pentamethyloctan-4-amine.
| Compound Name | 3-methoxy-N,2,2,7,7-pentamethyloctan-4-amine |
|---|---|
| PubChem CID | 116724435 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | 3-methoxy-N,2,2,7,7-pentamethyloctan-4-amine |
| SMILES | CNC(CCC(C)(C)C)C(OC)C(C)(C)C |
| InChI | InChI=1S/C14H31NO/c1-13(2,3)10-9-11(15-7)12(16-8)14(4,5)6/h11-12,15H,9-10H2,1-8H3 |
| InChIKey | TVTQESJXYRIRDE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |