C17H39N — CID 142059377
ethane;prop-1-ene;N,3,7,7-tetramethyloctan-4-amine (PubChem CID 142059377) has the molecular formula C17H39N and a molecular weight of 257.51 g/mol. Its IUPAC name is ethane;prop-1-ene;N,3,7,7-tetramethyloctan-4-amine.
| Compound Name | ethane;prop-1-ene;N,3,7,7-tetramethyloctan-4-amine |
|---|---|
| PubChem CID | 142059377 |
| Molecular Formula | C17H39N |
| Molecular Weight | 257.51 g/mol |
| Exact Mass | 257.31 |
| IUPAC Name | ethane;prop-1-ene;N,3,7,7-tetramethyloctan-4-amine |
| SMILES | C=CC.CC.CCC(C)C(CCC(C)(C)C)NC |
| InChI | InChI=1S/C12H27N.C3H6.C2H6/c1-7-10(2)11(13-6)8-9-12(3,4)5;1-3-2;1-2/h10-11,13H,7-9H2,1-6H3;3H,1H2,2H3;1-2H3 |
| InChIKey | ANEYONSHVKIJOC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|