C12H26O — CID 169306082
(5S)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy]hexane (PubChem CID 169306082) has the molecular formula C12H26O and a molecular weight of 186.34 g/mol. Its IUPAC name is (5S)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy]hexane.
| Compound Name | (5S)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
|---|---|
| PubChem CID | 169306082 |
| Molecular Formula | C12H26O |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.20 |
| IUPAC Name | (5S)-2,2-dimethyl-5-[(2-methylpropan-2-yl)oxy]hexane |
| SMILES | C[C@@H](CCC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C12H26O/c1-10(13-12(5,6)7)8-9-11(2,3)4/h10H,8-9H2,1-7H3/t10-/m0/s1 |
| InChIKey | GYUUYOAALPLYPX-JTQLQIEISA-N |
| XLogP | 4.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |