C15H30O — CID 123576567
2,2-dimethyl-8-[(2-methylpropan-2-yl)oxy]non-3-ene (PubChem CID 123576567) has the molecular formula C15H30O and a molecular weight of 226.40 g/mol. Its IUPAC name is 2,2-dimethyl-8-[(2-methylpropan-2-yl)oxy]non-3-ene.
| Compound Name | 2,2-dimethyl-8-[(2-methylpropan-2-yl)oxy]non-3-ene |
|---|---|
| PubChem CID | 123576567 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | 2,2-dimethyl-8-[(2-methylpropan-2-yl)oxy]non-3-ene |
| SMILES | CC(CCCC=CC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C15H30O/c1-13(16-15(5,6)7)11-9-8-10-12-14(2,3)4/h10,12-13H,8-9,11H2,1-7H3 |
| InChIKey | ULZDKHZDDHCTAN-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|