C13H26O — CID 123712551
(6R)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxy]hept-3-ene (PubChem CID 123712551) has the molecular formula C13H26O and a molecular weight of 198.35 g/mol. Its IUPAC name is (6R)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxy]hept-3-ene.
| Compound Name | (6R)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxy]hept-3-ene |
|---|---|
| PubChem CID | 123712551 |
| Molecular Formula | C13H26O |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.20 |
| IUPAC Name | (6R)-2,2-dimethyl-6-[(2-methylpropan-2-yl)oxy]hept-3-ene |
| SMILES | C[C@H](CC=CC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C13H26O/c1-11(14-13(5,6)7)9-8-10-12(2,3)4/h8,10-11H,9H2,1-7H3/t11-/m1/s1 |
| InChIKey | WILOGXGBRKEZNN-LLVKDONJSA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|