About 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol
3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol (PubChem CID 130392369) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol.
Molecular Properties
| Compound Name | 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol |
| PubChem CID | 130392369 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol |
| SMILES | CC(CCO)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H26O2/c1-10(7-8-13)14-12(5,6)9-11(2,3)4/h10,13H,7-9H2,1-6H3 |
| InChIKey | ONPBCWWCGQUNQN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol?
The IUPAC name of 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol (CID 130392369) is 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol.
What is the SMILES notation for 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol?
The canonical SMILES for 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol is CC(CCO)OC(C)(C)CC(C)(C)C.
What is the InChIKey of 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol?
The InChIKey is ONPBCWWCGQUNQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-10(7-8-13)14-12(5,6)9-11(2,3)4/h10,13H,7-9H2,1-6H3.
What are the key properties of 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol?
3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol has a molecular weight of 202.34 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4,4-trimethylpentan-2-yloxy)butan-1-ol is sourced from PubChem (CID 130392369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).