C17H36O3 — CID 164583763
2,2,4-trimethyl-4-[1-(1-propoxypropan-2-yloxy)propan-2-yloxy]pentane (PubChem CID 164583763) has the molecular formula C17H36O3 and a molecular weight of 288.47 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-[1-(1-propoxypropan-2-yloxy)propan-2-yloxy]pentane.
| Compound Name | 2,2,4-trimethyl-4-[1-(1-propoxypropan-2-yloxy)propan-2-yloxy]pentane |
|---|---|
| PubChem CID | 164583763 |
| Molecular Formula | C17H36O3 |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.27 |
| IUPAC Name | 2,2,4-trimethyl-4-[1-(1-propoxypropan-2-yloxy)propan-2-yloxy]pentane |
| SMILES | CCCOCC(C)OCC(C)OC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H36O3/c1-9-10-18-11-14(2)19-12-15(3)20-17(7,8)13-16(4,5)6/h14-15H,9-13H2,1-8H3 |
| InChIKey | AOTYDVJXRHYXNC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|