C16H34O4 — CID 155769092
3-[(2-methylpropan-2-yl)oxy]-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]butane (PubChem CID 155769092) has the molecular formula C16H34O4 and a molecular weight of 290.44 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxy]-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]butane.
| Compound Name | 3-[(2-methylpropan-2-yl)oxy]-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]butane |
|---|---|
| PubChem CID | 155769092 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxy]-1-[2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]ethoxy]butane |
| SMILES | CC(CCOCCOCCOC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C16H34O4/c1-14(20-16(5,6)7)8-9-17-10-11-18-12-13-19-15(2,3)4/h14H,8-13H2,1-7H3 |
| InChIKey | PLTZFPVQNAIEST-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|