C12H25ClO4S — CID 112590342
3-methyl-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane-1-sulfonyl chloride (PubChem CID 112590342) has the molecular formula C12H25ClO4S and a molecular weight of 300.85 g/mol. Its IUPAC name is 3-methyl-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane-1-sulfonyl chloride.
| Compound Name | 3-methyl-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 112590342 |
| Molecular Formula | C12H25ClO4S |
| Molecular Weight | 300.85 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 3-methyl-5-[2-[(2-methylpropan-2-yl)oxy]ethoxy]pentane-1-sulfonyl chloride |
| SMILES | CC(CCOCCOC(C)(C)C)CCS(=O)(=O)Cl |
| InChI | InChI=1S/C12H25ClO4S/c1-11(6-10-18(13,14)15)5-7-16-8-9-17-12(2,3)4/h11H,5-10H2,1-4H3 |
| InChIKey | UXZDCKCNERIBTQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.85 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|