C11H21F2N — CID 103516567
3-cyclopentyl-1,1-difluoro-N-propylpropan-2-amine (PubChem CID 103516567) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is 3-cyclopentyl-1,1-difluoro-N-propylpropan-2-amine.
| Compound Name | 3-cyclopentyl-1,1-difluoro-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 103516567 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 3-cyclopentyl-1,1-difluoro-N-propylpropan-2-amine |
| SMILES | CCCNC(CC1CCCC1)C(F)F |
| InChI | InChI=1S/C11H21F2N/c1-2-7-14-10(11(12)13)8-9-5-3-4-6-9/h9-11,14H,2-8H2,1H3 |
| InChIKey | OOJYUXQLBGBIPV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |