azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid

C8H21N3O3 — CID 158383672

IUPACazane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid
SMILESCC(C)C[C@H](NN)[C@@H](O)CC(=O)O.N
InChIInChI=1S/C8H18N2O3.H3N/c1-5(2)3-6(10-9)7(11)4-8(12)13;/h5-7,10-11H,3-4,9H2,1-2H3,(H,12,13);1H3/t6-,7-;/m0./s1
InChIKeyLGXDVDOVIPYKPF-LEUCUCNGSA-N
MW207.27 g/mol
LogP-0.14
Rot. Bonds6

About azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid

azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid (PubChem CID 158383672) has the molecular formula C8H21N3O3 and a molecular weight of 207.27 g/mol. Its IUPAC name is azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid.

Molecular Properties

Compound Nameazane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid
PubChem CID158383672
Molecular FormulaC8H21N3O3
Molecular Weight207.27 g/mol
Exact Mass207.16
IUPAC Nameazane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid
SMILESCC(C)C[C@H](NN)[C@@H](O)CC(=O)O.N
InChIInChI=1S/C8H18N2O3.H3N/c1-5(2)3-6(10-9)7(11)4-8(12)13;/h5-7,10-11H,3-4,9H2,1-2H3,(H,12,13);1H3/t6-,7-;/m0./s1
InChIKeyLGXDVDOVIPYKPF-LEUCUCNGSA-N
XLogP-0.14
TPSA130.58 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.27
LogP ≤ 5-0.14
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid?
The IUPAC name of azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid (CID 158383672) is azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid.
What is the SMILES notation for azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid?
The canonical SMILES for azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid is CC(C)C[C@H](NN)[C@@H](O)CC(=O)O.N.
What is the InChIKey of azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid?
The InChIKey is LGXDVDOVIPYKPF-LEUCUCNGSA-N. The full InChI is InChI=1S/C8H18N2O3.H3N/c1-5(2)3-6(10-9)7(11)4-8(12)13;/h5-7,10-11H,3-4,9H2,1-2H3,(H,12,13);1H3/t6-,7-;/m0./s1.
What are the key properties of azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid?
azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid has a molecular weight of 207.27 g/mol, XLogP of -0.14, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid is sourced from PubChem (CID 158383672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).