C8H21N3O3 — CID 158383672
azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid (PubChem CID 158383672) has the molecular formula C8H21N3O3 and a molecular weight of 207.27 g/mol. Its IUPAC name is azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid.
| Compound Name | azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid |
|---|---|
| PubChem CID | 158383672 |
| Molecular Formula | C8H21N3O3 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | azane;(3S,4S)-4-hydrazinyl-3-hydroxy-6-methylheptanoic acid |
| SMILES | CC(C)C[C@H](NN)[C@@H](O)CC(=O)O.N |
| InChI | InChI=1S/C8H18N2O3.H3N/c1-5(2)3-6(10-9)7(11)4-8(12)13;/h5-7,10-11H,3-4,9H2,1-2H3,(H,12,13);1H3/t6-,7-;/m0./s1 |
| InChIKey | LGXDVDOVIPYKPF-LEUCUCNGSA-N |
| XLogP | -0.14 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|