C11H21FN2O4 — CID 22986894
3-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-fluoro-4-hydroxypentanoic acid (PubChem CID 22986894) has the molecular formula C11H21FN2O4 and a molecular weight of 264.30 g/mol. Its IUPAC name is 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-fluoro-4-hydroxypentanoic acid.
| Compound Name | 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-fluoro-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 22986894 |
| Molecular Formula | C11H21FN2O4 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[[(2S)-2-amino-4-methylpentanoyl]amino]-5-fluoro-4-hydroxypentanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)NC(CC(=O)O)C(O)CF |
| InChI | InChI=1S/C11H21FN2O4/c1-6(2)3-7(13)11(18)14-8(4-10(16)17)9(15)5-12/h6-9,15H,3-5,13H2,1-2H3,(H,14,18)(H,16,17)/t7-,8?,9?/m0/s1 |
| InChIKey | OANINUBOWCSJGA-UEJVZZJDSA-N |
| XLogP | -0.35 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |