C21H33N3O8 — CID 11113216
(3S)-3-[[(2S,3S,4R,5S)-5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 11113216) has the molecular formula C21H33N3O8 and a molecular weight of 455.51 g/mol. Its IUPAC name is (3S)-3-[[(2S,3S,4R,5S)-5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[[(2S,3S,4R,5S)-5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11113216 |
| Molecular Formula | C21H33N3O8 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | (3S)-3-[[(2S,3S,4R,5S)-5-[[(2S)-2-amino-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CO)[C@@H](O)[C@H](O)[C@H](O)C(=O)N[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H33N3O8/c1-11(2)8-13(22)20(31)24-15(10-25)17(28)18(29)19(30)21(32)23-14(9-16(26)27)12-6-4-3-5-7-12/h3-7,11,13-15,17-19,25,28-30H,8-10,22H2,1-2H3,(H,23,32)(H,24,31)(H,26,27)/t13-,14-,15-,17+,18-,19-/m0/s1 |
| InChIKey | PSSAPTMCCOBBEJ-KCZNZURUSA-N |
| XLogP | -1.75 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |