C25H40N4O9S — CID 10951950
(3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-aminopentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 10951950) has the molecular formula C25H40N4O9S and a molecular weight of 572.68 g/mol. Its IUPAC name is (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-aminopentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-aminopentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10951950 |
| Molecular Formula | C25H40N4O9S |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-aminopentanoyl]amino]-4-methylsulfanylbutanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCC[C@H](N)C(=O)N[C@@H](CCSC)C(=O)N[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)C(=O)N[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H40N4O9S/c1-3-7-15(26)23(36)27-16(10-11-39-2)24(37)29-18(13-30)20(33)21(34)22(35)25(38)28-17(12-19(31)32)14-8-5-4-6-9-14/h4-6,8-9,15-18,20-22,30,33-35H,3,7,10-13,26H2,1-2H3,(H,27,36)(H,28,38)(H,29,37)(H,31,32)/t15-,16-,17-,18-,20+,21+,22-/m0/s1 |
| InChIKey | RSAMATNUOLWGFL-UQJCPLMDSA-N |
| XLogP | -1.76 |
| TPSA | 231.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |