C25H38N4O9S — CID 11114485
(3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]pent-4-enoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 11114485) has the molecular formula C25H38N4O9S and a molecular weight of 570.67 g/mol. Its IUPAC name is (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]pent-4-enoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]pent-4-enoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11114485 |
| Molecular Formula | C25H38N4O9S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | (3S)-3-[[(2S,3R,4R,5S)-5-[[(2S)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]pent-4-enoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C=CC[C@H](NC(=O)[C@@H](N)CCSC)C(=O)N[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)C(=O)N[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C25H38N4O9S/c1-3-7-16(27-23(36)15(26)10-11-39-2)24(37)29-18(13-30)20(33)21(34)22(35)25(38)28-17(12-19(31)32)14-8-5-4-6-9-14/h3-6,8-9,15-18,20-22,30,33-35H,1,7,10-13,26H2,2H3,(H,27,36)(H,28,38)(H,29,37)(H,31,32)/t15-,16-,17-,18-,20+,21+,22-/m0/s1 |
| InChIKey | HDUNRWRHWZGCOJ-UQJCPLMDSA-N |
| XLogP | -1.98 |
| TPSA | 231.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|