C26H40N4O9 — CID 18466027
3-[[5-[[2-(2-aminopent-4-enoylamino)-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 18466027) has the molecular formula C26H40N4O9 and a molecular weight of 552.63 g/mol. Its IUPAC name is 3-[[5-[[2-(2-aminopent-4-enoylamino)-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[5-[[2-(2-aminopent-4-enoylamino)-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18466027 |
| Molecular Formula | C26H40N4O9 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 3-[[5-[[2-(2-aminopent-4-enoylamino)-4-methylpentanoyl]amino]-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C=CCC(N)C(=O)NC(CC(C)C)C(=O)NC(CO)C(O)C(O)C(O)C(=O)NC(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H40N4O9/c1-4-8-16(27)24(37)29-18(11-14(2)3)25(38)30-19(13-31)21(34)22(35)23(36)26(39)28-17(12-20(32)33)15-9-6-5-7-10-15/h4-7,9-10,14,16-19,21-23,31,34-36H,1,8,11-13,27H2,2-3H3,(H,28,39)(H,29,37)(H,30,38)(H,32,33) |
| InChIKey | LBMYMNKWZBSPAX-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 231.54 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|