C19H29N3O8 — CID 10971987
(3S)-3-[[(2S,3R,4R,5S)-5-(4-aminobutanoylamino)-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 10971987) has the molecular formula C19H29N3O8 and a molecular weight of 427.45 g/mol. Its IUPAC name is (3S)-3-[[(2S,3R,4R,5S)-5-(4-aminobutanoylamino)-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (3S)-3-[[(2S,3R,4R,5S)-5-(4-aminobutanoylamino)-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10971987 |
| Molecular Formula | C19H29N3O8 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (3S)-3-[[(2S,3R,4R,5S)-5-(4-aminobutanoylamino)-2,3,4,6-tetrahydroxyhexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCC(=O)N[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)C(=O)N[C@@H](CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H29N3O8/c20-8-4-7-14(24)21-13(10-23)16(27)17(28)18(29)19(30)22-12(9-15(25)26)11-5-2-1-3-6-11/h1-3,5-6,12-13,16-18,23,27-29H,4,7-10,20H2,(H,21,24)(H,22,30)(H,25,26)/t12-,13-,16+,17+,18-/m0/s1 |
| InChIKey | VWXMPEUPDHNPJO-QXWBOSQLSA-N |
| XLogP | -2.38 |
| TPSA | 202.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |