C9H19NO4 — CID 172551344
(3S,4S)-3-hydroxy-4-(hydroxymethylamino)-6-methylheptanoic acid (PubChem CID 172551344) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is (3S,4S)-3-hydroxy-4-(hydroxymethylamino)-6-methylheptanoic acid.
| Compound Name | (3S,4S)-3-hydroxy-4-(hydroxymethylamino)-6-methylheptanoic acid |
|---|---|
| PubChem CID | 172551344 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3S,4S)-3-hydroxy-4-(hydroxymethylamino)-6-methylheptanoic acid |
| SMILES | CC(C)C[C@H](NCO)[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C9H19NO4/c1-6(2)3-7(10-5-11)8(12)4-9(13)14/h6-8,10-12H,3-5H2,1-2H3,(H,13,14)/t7-,8-/m0/s1 |
| InChIKey | RTQLFUPXMNUAHJ-YUMQZZPRSA-N |
| XLogP | -0.22 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|