C13H28 — CID 57491411
2,4,6-trimethyl-3-propan-2-ylheptane (PubChem CID 57491411) has the molecular formula C13H28 and a molecular weight of 184.37 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-propan-2-ylheptane.
| Compound Name | 2,4,6-trimethyl-3-propan-2-ylheptane |
|---|---|
| PubChem CID | 57491411 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 2,4,6-trimethyl-3-propan-2-ylheptane |
| SMILES | CC(C)CC(C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C13H28/c1-9(2)8-12(7)13(10(3)4)11(5)6/h9-13H,8H2,1-7H3 |
| InChIKey | XYPUTUUHYLWAIU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |