C20H42 — CID 123283653
5-hexan-3-yl-2,3,4,6,8-pentamethylnonane (PubChem CID 123283653) has the molecular formula C20H42 and a molecular weight of 282.56 g/mol. Its IUPAC name is 5-hexan-3-yl-2,3,4,6,8-pentamethylnonane.
| Compound Name | 5-hexan-3-yl-2,3,4,6,8-pentamethylnonane |
|---|---|
| PubChem CID | 123283653 |
| Molecular Formula | C20H42 |
| Molecular Weight | 282.56 g/mol |
| Exact Mass | 282.33 |
| IUPAC Name | 5-hexan-3-yl-2,3,4,6,8-pentamethylnonane |
| SMILES | CCCC(CC)C(C(C)CC(C)C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C20H42/c1-10-12-19(11-2)20(16(7)13-14(3)4)18(9)17(8)15(5)6/h14-20H,10-13H2,1-9H3 |
| InChIKey | IMZXRBQSHWJDQO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |