C14H30 — CID 57492474
5-ethyl-2,3,4,7-tetramethyloctane (PubChem CID 57492474) has the molecular formula C14H30 and a molecular weight of 198.39 g/mol. Its IUPAC name is 5-ethyl-2,3,4,7-tetramethyloctane.
| Compound Name | 5-ethyl-2,3,4,7-tetramethyloctane |
|---|---|
| PubChem CID | 57492474 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 5-ethyl-2,3,4,7-tetramethyloctane |
| SMILES | CCC(CC(C)C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C14H30/c1-8-14(9-10(2)3)13(7)12(6)11(4)5/h10-14H,8-9H2,1-7H3 |
| InChIKey | NONJMQRXFAEDOR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |