C29H64 — CID 158124922
bis(3-ethyl-2,5-dimethylhexane);2,3,5-trimethylhexane (PubChem CID 158124922) has the molecular formula C29H64 and a molecular weight of 412.83 g/mol. Its IUPAC name is bis(3-ethyl-2,5-dimethylhexane);2,3,5-trimethylhexane.
| Compound Name | bis(3-ethyl-2,5-dimethylhexane);2,3,5-trimethylhexane |
|---|---|
| PubChem CID | 158124922 |
| Molecular Formula | C29H64 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.50 |
| IUPAC Name | bis(3-ethyl-2,5-dimethylhexane);2,3,5-trimethylhexane |
| SMILES | CC(C)CC(C)C(C)C.CCC(CC(C)C)C(C)C.CCC(CC(C)C)C(C)C |
| InChI | InChI=1S/2C10H22.C9H20/c2*1-6-10(9(4)5)7-8(2)3;1-7(2)6-9(5)8(3)4/h2*8-10H,6-7H2,1-5H3;7-9H,6H2,1-5H3 |
| InChIKey | FSAYYRSRQGKBDY-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |