C13H30 — CID 142330758
ethane;4-ethyl-2,3-dimethylheptane (PubChem CID 142330758) has the molecular formula C13H30 and a molecular weight of 186.38 g/mol. Its IUPAC name is ethane;4-ethyl-2,3-dimethylheptane.
| Compound Name | ethane;4-ethyl-2,3-dimethylheptane |
|---|---|
| PubChem CID | 142330758 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | ethane;4-ethyl-2,3-dimethylheptane |
| SMILES | CC.CCCC(CC)C(C)C(C)C |
| InChI | InChI=1S/C11H24.C2H6/c1-6-8-11(7-2)10(5)9(3)4;1-2/h9-11H,6-8H2,1-5H3;1-2H3 |
| InChIKey | PDWLLKIJTCTSPD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |