C21H44 — CID 123304219
4-ethyl-2,3,9-trimethylhexadecane (PubChem CID 123304219) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 4-ethyl-2,3,9-trimethylhexadecane.
| Compound Name | 4-ethyl-2,3,9-trimethylhexadecane |
|---|---|
| PubChem CID | 123304219 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 4-ethyl-2,3,9-trimethylhexadecane |
| SMILES | CCCCCCCC(C)CCCCC(CC)C(C)C(C)C |
| InChI | InChI=1S/C21H44/c1-7-9-10-11-12-15-19(5)16-13-14-17-21(8-2)20(6)18(3)4/h18-21H,7-17H2,1-6H3 |
| InChIKey | CIADLDMTWCWZDA-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|