C17H36 — CID 90755621
4,5-diethyl-2,3-dimethylundecane (PubChem CID 90755621) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 4,5-diethyl-2,3-dimethylundecane.
| Compound Name | 4,5-diethyl-2,3-dimethylundecane |
|---|---|
| PubChem CID | 90755621 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 4,5-diethyl-2,3-dimethylundecane |
| SMILES | CCCCCCC(CC)C(CC)C(C)C(C)C |
| InChI | InChI=1S/C17H36/c1-7-10-11-12-13-16(8-2)17(9-3)15(6)14(4)5/h14-17H,7-13H2,1-6H3 |
| InChIKey | ZPHRHSXOMUJXFC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|