C21H44 — CID 159934910
2,4,5,6,8,9,10,12-octamethyltridecane (PubChem CID 159934910) has the molecular formula C21H44 and a molecular weight of 296.58 g/mol. Its IUPAC name is 2,4,5,6,8,9,10,12-octamethyltridecane.
| Compound Name | 2,4,5,6,8,9,10,12-octamethyltridecane |
|---|---|
| PubChem CID | 159934910 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 2,4,5,6,8,9,10,12-octamethyltridecane |
| SMILES | CC(C)CC(C)C(C)C(C)CC(C)C(C)C(C)CC(C)C |
| InChI | InChI=1S/C21H44/c1-14(2)11-16(5)20(9)18(7)13-19(8)21(10)17(6)12-15(3)4/h14-21H,11-13H2,1-10H3 |
| InChIKey | RFBDKUVNHXDVBX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |