About azane;4-methylpent-1-en-3-ol
azane;4-methylpent-1-en-3-ol (PubChem CID 175575018) has the molecular formula C6H15NO
and a molecular weight of 117.19 g/mol. Its IUPAC name is azane;4-methylpent-1-en-3-ol.
Molecular Properties
| Compound Name | azane;4-methylpent-1-en-3-ol |
| PubChem CID | 175575018 |
| Molecular Formula | C6H15NO |
| Molecular Weight | 117.19 g/mol |
| Exact Mass | 117.12 |
| IUPAC Name | azane;4-methylpent-1-en-3-ol |
| SMILES | C=CC(O)C(C)C.N |
| InChI | InChI=1S/C6H12O.H3N/c1-4-6(7)5(2)3;/h4-7H,1H2,2-3H3;1H3 |
| InChIKey | HINICQWMIXYQPJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;4-methylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-methylpent-1-en-3-ol?
The IUPAC name of azane;4-methylpent-1-en-3-ol (CID 175575018) is azane;4-methylpent-1-en-3-ol.
What is the SMILES notation for azane;4-methylpent-1-en-3-ol?
The canonical SMILES for azane;4-methylpent-1-en-3-ol is C=CC(O)C(C)C.N.
What is the InChIKey of azane;4-methylpent-1-en-3-ol?
The InChIKey is HINICQWMIXYQPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.H3N/c1-4-6(7)5(2)3;/h4-7H,1H2,2-3H3;1H3.
What are the key properties of azane;4-methylpent-1-en-3-ol?
azane;4-methylpent-1-en-3-ol has a molecular weight of 117.19 g/mol, XLogP of 1.35, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-methylpent-1-en-3-ol is sourced from PubChem (CID 175575018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).