About azane;1-chloroprop-2-en-1-ol
azane;1-chloroprop-2-en-1-ol (PubChem CID 118499684) has the molecular formula C3H8ClNO
and a molecular weight of 109.56 g/mol. Its IUPAC name is azane;1-chloroprop-2-en-1-ol.
Molecular Properties
| Compound Name | azane;1-chloroprop-2-en-1-ol |
| PubChem CID | 118499684 |
| Molecular Formula | C3H8ClNO |
| Molecular Weight | 109.56 g/mol |
| Exact Mass | 109.03 |
| IUPAC Name | azane;1-chloroprop-2-en-1-ol |
| SMILES | C=CC(O)Cl.N |
| InChI | InChI=1S/C3H5ClO.H3N/c1-2-3(4)5;/h2-3,5H,1H2;1H3 |
| InChIKey | XFROCFSISZJBEL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.56 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;1-chloroprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-chloroprop-2-en-1-ol?
The IUPAC name of azane;1-chloroprop-2-en-1-ol (CID 118499684) is azane;1-chloroprop-2-en-1-ol.
What is the SMILES notation for azane;1-chloroprop-2-en-1-ol?
The canonical SMILES for azane;1-chloroprop-2-en-1-ol is C=CC(O)Cl.N.
What is the InChIKey of azane;1-chloroprop-2-en-1-ol?
The InChIKey is XFROCFSISZJBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO.H3N/c1-2-3(4)5;/h2-3,5H,1H2;1H3.
What are the key properties of azane;1-chloroprop-2-en-1-ol?
azane;1-chloroprop-2-en-1-ol has a molecular weight of 109.56 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-chloroprop-2-en-1-ol is sourced from PubChem (CID 118499684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).