About 3-chloropenta-1,4-diene;silane
3-chloropenta-1,4-diene;silane (PubChem CID 174807619) has the molecular formula C5H11ClSi
and a molecular weight of 134.68 g/mol. Its IUPAC name is 3-chloropenta-1,4-diene;silane.
Molecular Properties
| Compound Name | 3-chloropenta-1,4-diene;silane |
| PubChem CID | 174807619 |
| Molecular Formula | C5H11ClSi |
| Molecular Weight | 134.68 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 3-chloropenta-1,4-diene;silane |
| SMILES | C=CC(Cl)C=C.[SiH4] |
| InChI | InChI=1S/C5H7Cl.H4Si/c1-3-5(6)4-2;/h3-5H,1-2H2;1H4 |
| InChIKey | SMZOUYYGPPFQPO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.68 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropenta-1,4-diene;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropenta-1,4-diene;silane?
The IUPAC name of 3-chloropenta-1,4-diene;silane (CID 174807619) is 3-chloropenta-1,4-diene;silane.
What is the SMILES notation for 3-chloropenta-1,4-diene;silane?
The canonical SMILES for 3-chloropenta-1,4-diene;silane is C=CC(Cl)C=C.[SiH4].
What is the InChIKey of 3-chloropenta-1,4-diene;silane?
The InChIKey is SMZOUYYGPPFQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7Cl.H4Si/c1-3-5(6)4-2;/h3-5H,1-2H2;1H4.
What are the key properties of 3-chloropenta-1,4-diene;silane?
3-chloropenta-1,4-diene;silane has a molecular weight of 134.68 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropenta-1,4-diene;silane is sourced from PubChem (CID 174807619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).