C10H10ClFO — CID 102462512
(1S,2S)-2-chloro-1-(4-fluorophenyl)but-3-en-1-ol (PubChem CID 102462512) has the molecular formula C10H10ClFO and a molecular weight of 200.64 g/mol. Its IUPAC name is (1S,2S)-2-chloro-1-(4-fluorophenyl)but-3-en-1-ol.
| Compound Name | (1S,2S)-2-chloro-1-(4-fluorophenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 102462512 |
| Molecular Formula | C10H10ClFO |
| Molecular Weight | 200.64 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | (1S,2S)-2-chloro-1-(4-fluorophenyl)but-3-en-1-ol |
| SMILES | C=C[C@H](Cl)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H10ClFO/c1-2-9(11)10(13)7-3-5-8(12)6-4-7/h2-6,9-10,13H,1H2/t9-,10-/m0/s1 |
| InChIKey | FHWUXNKXQIMBPB-UWVGGRQHSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.64 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|