C10H9FO — CID 130831291
(1R)-1-(4-fluorophenyl)buta-2,3-dien-1-ol (PubChem CID 130831291) has the molecular formula C10H9FO and a molecular weight of 164.18 g/mol. Its IUPAC name is (1R)-1-(4-fluorophenyl)buta-2,3-dien-1-ol.
| Compound Name | (1R)-1-(4-fluorophenyl)buta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 130831291 |
| Molecular Formula | C10H9FO |
| Molecular Weight | 164.18 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1R)-1-(4-fluorophenyl)buta-2,3-dien-1-ol |
| SMILES | C=C=C[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h3-7,10,12H,1H2/t10-/m1/s1 |
| InChIKey | AMTGPFLJLBPZBK-SNVBAGLBSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |