C13H16O — CID 130125593
4-methyl-1-(4-methylphenyl)penta-2,3-dien-1-ol (PubChem CID 130125593) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-methyl-1-(4-methylphenyl)penta-2,3-dien-1-ol.
| Compound Name | 4-methyl-1-(4-methylphenyl)penta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 130125593 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-methyl-1-(4-methylphenyl)penta-2,3-dien-1-ol |
| SMILES | CC(C)=C=CC(O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H16O/c1-10(2)4-9-13(14)12-7-5-11(3)6-8-12/h5-9,13-14H,1-3H3 |
| InChIKey | AEAVGEMAABDCEH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |