C26H30O2 — CID 139087432
(1R,5S)-1,3,5-tris(4-methylphenyl)pentane-1,5-diol (PubChem CID 139087432) has the molecular formula C26H30O2 and a molecular weight of 374.52 g/mol. Its IUPAC name is (1R,5S)-1,3,5-tris(4-methylphenyl)pentane-1,5-diol.
| Compound Name | (1R,5S)-1,3,5-tris(4-methylphenyl)pentane-1,5-diol |
|---|---|
| PubChem CID | 139087432 |
| Molecular Formula | C26H30O2 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | (1R,5S)-1,3,5-tris(4-methylphenyl)pentane-1,5-diol |
| SMILES | Cc1ccc(C(C[C@@H](O)c2ccc(C)cc2)C[C@H](O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C26H30O2/c1-18-4-10-21(11-5-18)24(16-25(27)22-12-6-19(2)7-13-22)17-26(28)23-14-8-20(3)9-15-23/h4-15,24-28H,16-17H2,1-3H3/t24?,25-,26+ |
| InChIKey | WHGOKYNRPATIGW-NXMIGULDSA-N |
| XLogP | 5.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |