C11H15NO — CID 82125221
2-(aziridin-1-yl)-1-(4-methylphenyl)ethanol (PubChem CID 82125221) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-(aziridin-1-yl)-1-(4-methylphenyl)ethanol.
| Compound Name | 2-(aziridin-1-yl)-1-(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 82125221 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 2-(aziridin-1-yl)-1-(4-methylphenyl)ethanol |
| SMILES | Cc1ccc(C(O)CN2CC2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-9-2-4-10(5-3-9)11(13)8-12-6-7-12/h2-5,11,13H,6-8H2,1H3 |
| InChIKey | LKEOYGINYNVUAM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|