C19H24N2O2S — CID 111476671
[4-[2-hydroxy-2-(4-methylphenyl)ethyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone (PubChem CID 111476671) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is [4-[2-hydroxy-2-(4-methylphenyl)ethyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone.
| Compound Name | [4-[2-hydroxy-2-(4-methylphenyl)ethyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 111476671 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [4-[2-hydroxy-2-(4-methylphenyl)ethyl]piperazin-1-yl]-(5-methylthiophen-2-yl)methanone |
| SMILES | Cc1ccc(C(O)CN2CCN(C(=O)c3ccc(C)s3)CC2)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-14-3-6-16(7-4-14)17(22)13-20-9-11-21(12-10-20)19(23)18-8-5-15(2)24-18/h3-8,17,22H,9-13H2,1-2H3 |
| InChIKey | WISJCBSQQXPZAE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |