C20H24ClFN2O — CID 167888942
2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-(4-methylphenyl)ethanol (PubChem CID 167888942) has the molecular formula C20H24ClFN2O and a molecular weight of 362.88 g/mol. Its IUPAC name is 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-(4-methylphenyl)ethanol.
| Compound Name | 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-(4-methylphenyl)ethanol |
|---|---|
| PubChem CID | 167888942 |
| Molecular Formula | C20H24ClFN2O |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-1-(4-methylphenyl)ethanol |
| SMILES | Cc1ccc(C(O)CN2CCN(Cc3c(F)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H24ClFN2O/c1-15-5-7-16(8-6-15)20(25)14-24-11-9-23(10-12-24)13-17-18(21)3-2-4-19(17)22/h2-8,20,25H,9-14H2,1H3 |
| InChIKey | BZKLGIOUADOIBR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |