C17H26ClFN2O2 — CID 3701376
1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 3701376) has the molecular formula C17H26ClFN2O2 and a molecular weight of 344.86 g/mol. Its IUPAC name is 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 3701376 |
| Molecular Formula | C17H26ClFN2O2 |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C17H26ClFN2O2/c1-13(2)23-12-14(22)10-20-6-8-21(9-7-20)11-15-16(18)4-3-5-17(15)19/h3-5,13-14,22H,6-12H2,1-2H3 |
| InChIKey | VMEFZNJYYMYPNV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |