C16H23ClFNO2 — CID 78832763
1-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]-3-propan-2-yloxypropan-2-ol (PubChem CID 78832763) has the molecular formula C16H23ClFNO2 and a molecular weight of 315.82 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 78832763 |
| Molecular Formula | C16H23ClFNO2 |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl-cyclopropylamino]-3-propan-2-yloxypropan-2-ol |
| SMILES | CC(C)OCC(O)CN(Cc1c(F)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C16H23ClFNO2/c1-11(2)21-10-13(20)8-19(12-6-7-12)9-14-15(17)4-3-5-16(14)18/h3-5,11-13,20H,6-10H2,1-2H3 |
| InChIKey | VBOWNYKGOAVAEP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |